C19H25NO3 — CID 19797155
4-benzyl-3-(3-cyclohexylpropanoyl)-1,3-oxazolidin-2-one (PubChem CID 19797155) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 4-benzyl-3-(3-cyclohexylpropanoyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-(3-cyclohexylpropanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 19797155 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4-benzyl-3-(3-cyclohexylpropanoyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(CCC1CCCCC1)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO3/c21-18(12-11-15-7-3-1-4-8-15)20-17(14-23-19(20)22)13-16-9-5-2-6-10-16/h2,5-6,9-10,15,17H,1,3-4,7-8,11-14H2 |
| InChIKey | XRKVQEVODHSBJF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |