C27H27NO5 — CID 10026542
(4S)-4-benzyl-3-[(Z)-1-hydroxy-3-(4-methoxy-3-phenylmethoxyphenyl)prop-1-enyl]-1,3-oxazolidin-2-one (PubChem CID 10026542) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(Z)-1-hydroxy-3-(4-methoxy-3-phenylmethoxyphenyl)prop-1-enyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(Z)-1-hydroxy-3-(4-methoxy-3-phenylmethoxyphenyl)prop-1-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10026542 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (4S)-4-benzyl-3-[(Z)-1-hydroxy-3-(4-methoxy-3-phenylmethoxyphenyl)prop-1-enyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(C/C=C(\O)N2C(=O)OC[C@@H]2Cc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H27NO5/c1-31-24-14-12-21(17-25(24)32-18-22-10-6-3-7-11-22)13-15-26(29)28-23(19-33-27(28)30)16-20-8-4-2-5-9-20/h2-12,14-15,17,23,29H,13,16,18-19H2,1H3/b26-15-/t23-/m0/s1 |
| InChIKey | YZCPVTBBWSHMFY-VNAAUWNKSA-N |
| XLogP | 5.28 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|