C24H32N4O2 — CID 158412418
5-amino-5-(4-methylphenyl)pentan-2-one;5-azido-5-(4-methylphenyl)pentan-2-one (PubChem CID 158412418) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 5-amino-5-(4-methylphenyl)pentan-2-one;5-azido-5-(4-methylphenyl)pentan-2-one.
| Compound Name | 5-amino-5-(4-methylphenyl)pentan-2-one;5-azido-5-(4-methylphenyl)pentan-2-one |
|---|---|
| PubChem CID | 158412418 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 5-amino-5-(4-methylphenyl)pentan-2-one;5-azido-5-(4-methylphenyl)pentan-2-one |
| SMILES | CC(=O)CCC(N)c1ccc(C)cc1.CC(=O)CCC(N=[N+]=[N-])c1ccc(C)cc1 |
| InChI | InChI=1S/C12H15N3O.C12H17NO/c1-9-3-6-11(7-4-9)12(14-15-13)8-5-10(2)16;1-9-3-6-11(7-4-9)12(13)8-5-10(2)14/h3-4,6-7,12H,5,8H2,1-2H3;3-4,6-7,12H,5,8,13H2,1-2H3 |
| InChIKey | GZLZRGTYHCIJOT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|