C14H16NO6- — CID 131716436
3-[2,2-dimethyl-1-(4-nitrophenyl)propoxy]-3-oxopropanoate (PubChem CID 131716436) has the molecular formula C14H16NO6- and a molecular weight of 294.28 g/mol. Its IUPAC name is 3-[2,2-dimethyl-1-(4-nitrophenyl)propoxy]-3-oxopropanoate.
| Compound Name | 3-[2,2-dimethyl-1-(4-nitrophenyl)propoxy]-3-oxopropanoate |
|---|---|
| PubChem CID | 131716436 |
| Molecular Formula | C14H16NO6- |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-[2,2-dimethyl-1-(4-nitrophenyl)propoxy]-3-oxopropanoate |
| SMILES | CC(C)(C)C(OC(=O)CC(=O)[O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H17NO6/c1-14(2,3)13(21-12(18)8-11(16)17)9-4-6-10(7-5-9)15(19)20/h4-7,13H,8H2,1-3H3,(H,16,17)/p-1 |
| InChIKey | SVFXDORUKWENKK-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 109.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|