C14H20N4O2 — CID 175041010
[(2S)-1-azido-3-phenylpropan-2-yl] N-tert-butylcarbamate (PubChem CID 175041010) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is [(2S)-1-azido-3-phenylpropan-2-yl] N-tert-butylcarbamate.
| Compound Name | [(2S)-1-azido-3-phenylpropan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175041010 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | [(2S)-1-azido-3-phenylpropan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H](CN=[N+]=[N-])Cc1ccccc1 |
| InChI | InChI=1S/C14H20N4O2/c1-14(2,3)17-13(19)20-12(10-16-18-15)9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | LWCZSUAHHGFJKP-LBPRGKRZSA-N |
| XLogP | 3.43 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|