C15H20F2N4O3 — CID 142774984
[4-azido-1-(3,5-difluorophenyl)-4-hydroxybutan-2-yl] N-tert-butylcarbamate (PubChem CID 142774984) has the molecular formula C15H20F2N4O3 and a molecular weight of 342.35 g/mol. Its IUPAC name is [4-azido-1-(3,5-difluorophenyl)-4-hydroxybutan-2-yl] N-tert-butylcarbamate.
| Compound Name | [4-azido-1-(3,5-difluorophenyl)-4-hydroxybutan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 142774984 |
| Molecular Formula | C15H20F2N4O3 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [4-azido-1-(3,5-difluorophenyl)-4-hydroxybutan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(Cc1cc(F)cc(F)c1)CC(O)N=[N+]=[N-] |
| InChI | InChI=1S/C15H20F2N4O3/c1-15(2,3)19-14(23)24-12(8-13(22)20-21-18)6-9-4-10(16)7-11(17)5-9/h4-5,7,12-13,22H,6,8H2,1-3H3,(H,19,23) |
| InChIKey | AEKSAMMRHZPEME-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|