C16H22F3NO3 — CID 91246310
[(2S)-4-hydroxy-1-[4-(trifluoromethyl)phenyl]butan-2-yl] N-tert-butylcarbamate (PubChem CID 91246310) has the molecular formula C16H22F3NO3 and a molecular weight of 333.35 g/mol. Its IUPAC name is [(2S)-4-hydroxy-1-[4-(trifluoromethyl)phenyl]butan-2-yl] N-tert-butylcarbamate.
| Compound Name | [(2S)-4-hydroxy-1-[4-(trifluoromethyl)phenyl]butan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 91246310 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(2S)-4-hydroxy-1-[4-(trifluoromethyl)phenyl]butan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H](CCO)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3NO3/c1-15(2,3)20-14(22)23-13(8-9-21)10-11-4-6-12(7-5-11)16(17,18)19/h4-7,13,21H,8-10H2,1-3H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | KGVHNEBMVBEHQR-CYBMUJFWSA-N |
| XLogP | 3.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |