C17H25F2NO2 — CID 20790193
N-tert-butyl-2-[(3,5-difluorophenyl)methoxy]-4-methylpentanamide (PubChem CID 20790193) has the molecular formula C17H25F2NO2 and a molecular weight of 313.39 g/mol. Its IUPAC name is N-tert-butyl-2-[(3,5-difluorophenyl)methoxy]-4-methylpentanamide.
| Compound Name | N-tert-butyl-2-[(3,5-difluorophenyl)methoxy]-4-methylpentanamide |
|---|---|
| PubChem CID | 20790193 |
| Molecular Formula | C17H25F2NO2 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-tert-butyl-2-[(3,5-difluorophenyl)methoxy]-4-methylpentanamide |
| SMILES | CC(C)CC(OCc1cc(F)cc(F)c1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H25F2NO2/c1-11(2)6-15(16(21)20-17(3,4)5)22-10-12-7-13(18)9-14(19)8-12/h7-9,11,15H,6,10H2,1-5H3,(H,20,21) |
| InChIKey | IMLLHPOYAYMTKR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |