C15H23NO4 — CID 3220214
[1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] furan-2-carboxylate (PubChem CID 3220214) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is [1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] furan-2-carboxylate.
| Compound Name | [1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 3220214 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [1-(tert-butylamino)-4-methyl-1-oxopentan-2-yl] furan-2-carboxylate |
| SMILES | CC(C)CC(OC(=O)c1ccco1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H23NO4/c1-10(2)9-12(13(17)16-15(3,4)5)20-14(18)11-7-6-8-19-11/h6-8,10,12H,9H2,1-5H3,(H,16,17) |
| InChIKey | LFCPADBZNVBLKP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |