C30H38INO3Si — CID 175168341
[(2S)-1-[tert-butyl(diphenyl)silyl]oxy-3-(3-iodophenyl)propan-2-yl] N-tert-butylcarbamate (PubChem CID 175168341) has the molecular formula C30H38INO3Si and a molecular weight of 615.63 g/mol. Its IUPAC name is [(2S)-1-[tert-butyl(diphenyl)silyl]oxy-3-(3-iodophenyl)propan-2-yl] N-tert-butylcarbamate.
| Compound Name | [(2S)-1-[tert-butyl(diphenyl)silyl]oxy-3-(3-iodophenyl)propan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175168341 |
| Molecular Formula | C30H38INO3Si |
| Molecular Weight | 615.63 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | [(2S)-1-[tert-butyl(diphenyl)silyl]oxy-3-(3-iodophenyl)propan-2-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)Cc1cccc(I)c1 |
| InChI | InChI=1S/C30H38INO3Si/c1-29(2,3)32-28(33)35-25(21-23-14-13-15-24(31)20-23)22-34-36(30(4,5)6,26-16-9-7-10-17-26)27-18-11-8-12-19-27/h7-20,25H,21-22H2,1-6H3,(H,32,33)/t25-/m0/s1 |
| InChIKey | FXYBGGJXLRSBFT-VWLOTQADSA-N |
| XLogP | 6.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|