C18H22N4O4 — CID 175390180
[(1S)-1-[4-[(5-nitro-2-pyridinyl)amino]phenyl]ethyl] N-tert-butylcarbamate (PubChem CID 175390180) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is [(1S)-1-[4-[(5-nitro-2-pyridinyl)amino]phenyl]ethyl] N-tert-butylcarbamate.
| Compound Name | [(1S)-1-[4-[(5-nitro-2-pyridinyl)amino]phenyl]ethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175390180 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [(1S)-1-[4-[(5-nitro-2-pyridinyl)amino]phenyl]ethyl] N-tert-butylcarbamate |
| SMILES | C[C@H](OC(=O)NC(C)(C)C)c1ccc(Nc2ccc([N+](=O)[O-])cn2)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-12(26-17(23)21-18(2,3)4)13-5-7-14(8-6-13)20-16-10-9-15(11-19-16)22(24)25/h5-12H,1-4H3,(H,19,20)(H,21,23)/t12-/m0/s1 |
| InChIKey | HFQVMJZXJVGBAI-LBPRGKRZSA-N |
| XLogP | 4.32 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|