C14H21N3O8S — CID 90041316
2-[2-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 90041316) has the molecular formula C14H21N3O8S and a molecular weight of 391.40 g/mol. Its IUPAC name is 2-[2-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 90041316 |
| Molecular Formula | C14H21N3O8S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[2-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | CN(CCOCCOCCNC(=O)O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O8S/c1-16(7-9-25-11-10-24-8-6-15-14(18)19)26(22,23)13-5-3-2-4-12(13)17(20)21/h2-5,15H,6-11H2,1H3,(H,18,19) |
| InChIKey | PGMKRQBVVJJCCT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|