C11H14N2O7S — CID 129359712
(3R)-3-hydroxy-4-[(2-methyl-5-nitrophenyl)sulfonylamino]butanoic acid (PubChem CID 129359712) has the molecular formula C11H14N2O7S and a molecular weight of 318.31 g/mol. Its IUPAC name is (3R)-3-hydroxy-4-[(2-methyl-5-nitrophenyl)sulfonylamino]butanoic acid.
| Compound Name | (3R)-3-hydroxy-4-[(2-methyl-5-nitrophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 129359712 |
| Molecular Formula | C11H14N2O7S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (3R)-3-hydroxy-4-[(2-methyl-5-nitrophenyl)sulfonylamino]butanoic acid |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)NC[C@H](O)CC(=O)O |
| InChI | InChI=1S/C11H14N2O7S/c1-7-2-3-8(13(17)18)4-10(7)21(19,20)12-6-9(14)5-11(15)16/h2-4,9,12,14H,5-6H2,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | QCBLPDCAIJGZEY-SECBINFHSA-N |
| XLogP | 0.02 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|