C17H16N2O5S2 — CID 121179561
N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 121179561) has the molecular formula C17H16N2O5S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121179561 |
| Molecular Formula | C17H16N2O5S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCC(O)c1csc2ccccc12 |
| InChI | InChI=1S/C17H16N2O5S2/c1-11-6-7-12(19(21)22)8-17(11)26(23,24)18-9-15(20)14-10-25-16-5-3-2-4-13(14)16/h2-8,10,15,18,20H,9H2,1H3 |
| InChIKey | WBMRRHBEHAIOCX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|