C14H12BrNO3S3 — CID 121179574
N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-5-bromothiophene-2-sulfonamide (PubChem CID 121179574) has the molecular formula C14H12BrNO3S3 and a molecular weight of 418.36 g/mol. Its IUPAC name is N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-5-bromothiophene-2-sulfonamide.
| Compound Name | N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-5-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 121179574 |
| Molecular Formula | C14H12BrNO3S3 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 416.92 |
| IUPAC Name | N-[2-(1-benzothiophen-3-yl)-2-hydroxyethyl]-5-bromothiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(O)c1csc2ccccc12)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H12BrNO3S3/c15-13-5-6-14(21-13)22(18,19)16-7-11(17)10-8-20-12-4-2-1-3-9(10)12/h1-6,8,11,16-17H,7H2 |
| InChIKey | RCPGHCYMWTZGNL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |