C15H12ClNO6S — CID 2794568
4-(4-chloro-2,5-dimethylphenyl)sulfonyl-3-nitrobenzoic acid (PubChem CID 2794568) has the molecular formula C15H12ClNO6S and a molecular weight of 369.78 g/mol. Its IUPAC name is 4-(4-chloro-2,5-dimethylphenyl)sulfonyl-3-nitrobenzoic acid.
| Compound Name | 4-(4-chloro-2,5-dimethylphenyl)sulfonyl-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 2794568 |
| Molecular Formula | C15H12ClNO6S |
| Molecular Weight | 369.78 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 4-(4-chloro-2,5-dimethylphenyl)sulfonyl-3-nitrobenzoic acid |
| SMILES | Cc1cc(S(=O)(=O)c2ccc(C(=O)O)cc2[N+](=O)[O-])c(C)cc1Cl |
| InChI | InChI=1S/C15H12ClNO6S/c1-8-6-14(9(2)5-11(8)16)24(22,23)13-4-3-10(15(18)19)7-12(13)17(20)21/h3-7H,1-2H3,(H,18,19) |
| InChIKey | PSOCCUYOZSQCOF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|