C12H8Cl2N2O4S — CID 2799605
2-(2,4-dichloro-5-methylphenyl)sulfonyl-5-nitropyridine (PubChem CID 2799605) has the molecular formula C12H8Cl2N2O4S and a molecular weight of 347.18 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-methylphenyl)sulfonyl-5-nitropyridine.
| Compound Name | 2-(2,4-dichloro-5-methylphenyl)sulfonyl-5-nitropyridine |
|---|---|
| PubChem CID | 2799605 |
| Molecular Formula | C12H8Cl2N2O4S |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2-(2,4-dichloro-5-methylphenyl)sulfonyl-5-nitropyridine |
| SMILES | Cc1cc(S(=O)(=O)c2ccc([N+](=O)[O-])cn2)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl2N2O4S/c1-7-4-11(10(14)5-9(7)13)21(19,20)12-3-2-8(6-15-12)16(17)18/h2-6H,1H3 |
| InChIKey | BPQWJZPSUYKDSY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 90.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|