C22H22Cl2N4O4S2 — CID 87551035
2-[4-(2,4-dichloro-5-methylphenyl)sulfonylpiperazin-1-yl]-4-[1-(4-nitrophenyl)ethyl]-1,3-thiazole (PubChem CID 87551035) has the molecular formula C22H22Cl2N4O4S2 and a molecular weight of 541.48 g/mol. Its IUPAC name is 2-[4-(2,4-dichloro-5-methylphenyl)sulfonylpiperazin-1-yl]-4-[1-(4-nitrophenyl)ethyl]-1,3-thiazole.
| Compound Name | 2-[4-(2,4-dichloro-5-methylphenyl)sulfonylpiperazin-1-yl]-4-[1-(4-nitrophenyl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 87551035 |
| Molecular Formula | C22H22Cl2N4O4S2 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | 2-[4-(2,4-dichloro-5-methylphenyl)sulfonylpiperazin-1-yl]-4-[1-(4-nitrophenyl)ethyl]-1,3-thiazole |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(c3nc(C(C)c4ccc([N+](=O)[O-])cc4)cs3)CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H22Cl2N4O4S2/c1-14-11-21(19(24)12-18(14)23)34(31,32)27-9-7-26(8-10-27)22-25-20(13-33-22)15(2)16-3-5-17(6-4-16)28(29)30/h3-6,11-13,15H,7-10H2,1-2H3 |
| InChIKey | FRXVDUYMCOXCJJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|