C19H18ClN5O6S3 — CID 87551789
2-[4-(5-chloro-4-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]-4-[2-(4-nitrophenyl)ethyl]-1,3-thiazole (PubChem CID 87551789) has the molecular formula C19H18ClN5O6S3 and a molecular weight of 544.04 g/mol. Its IUPAC name is 2-[4-(5-chloro-4-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]-4-[2-(4-nitrophenyl)ethyl]-1,3-thiazole.
| Compound Name | 2-[4-(5-chloro-4-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]-4-[2-(4-nitrophenyl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 87551789 |
| Molecular Formula | C19H18ClN5O6S3 |
| Molecular Weight | 544.04 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | 2-[4-(5-chloro-4-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]-4-[2-(4-nitrophenyl)ethyl]-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc(CCc2csc(N3CCN(S(=O)(=O)c4cc([N+](=O)[O-])c(Cl)s4)CC3)n2)cc1 |
| InChI | InChI=1S/C19H18ClN5O6S3/c20-18-16(25(28)29)11-17(33-18)34(30,31)23-9-7-22(8-10-23)19-21-14(12-32-19)4-1-13-2-5-15(6-3-13)24(26)27/h2-3,5-6,11-12H,1,4,7-10H2 |
| InChIKey | BTVVILPWSULMEC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 139.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.04 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|