C13H14N2O5S — CID 174316608
4-cyclobutylsulfonyl-2-methyl-N-methylidene-5-nitrobenzamide (PubChem CID 174316608) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 4-cyclobutylsulfonyl-2-methyl-N-methylidene-5-nitrobenzamide.
| Compound Name | 4-cyclobutylsulfonyl-2-methyl-N-methylidene-5-nitrobenzamide |
|---|---|
| PubChem CID | 174316608 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-cyclobutylsulfonyl-2-methyl-N-methylidene-5-nitrobenzamide |
| SMILES | C=NC(=O)c1cc([N+](=O)[O-])c(S(=O)(=O)C2CCC2)cc1C |
| InChI | InChI=1S/C13H14N2O5S/c1-8-6-12(21(19,20)9-4-3-5-9)11(15(17)18)7-10(8)13(16)14-2/h6-7,9H,2-5H2,1H3 |
| InChIKey | AQALMCZSSLSNDQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 106.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|