C16H23N3O4S2 — CID 22445916
4-cyclohexylsulfinyl-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide (PubChem CID 22445916) has the molecular formula C16H23N3O4S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-cyclohexylsulfinyl-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide.
| Compound Name | 4-cyclohexylsulfinyl-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 22445916 |
| Molecular Formula | C16H23N3O4S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-cyclohexylsulfinyl-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide |
| SMILES | Cc1cc(S(=O)C2CCCCC2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C16H23N3O4S2/c1-10-8-13(24(21)11-6-4-3-5-7-11)14(25(2,22)23)9-12(10)15(20)19-16(17)18/h8-9,11H,3-7H2,1-2H3,(H4,17,18,19,20) |
| InChIKey | TXWBBJXLIFAFRZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|