C16H21ClO5S2 — CID 18927193
4-cyclohexylsulfonyl-2-ethyl-5-methylsulfonylbenzoyl chloride (PubChem CID 18927193) has the molecular formula C16H21ClO5S2 and a molecular weight of 392.93 g/mol. Its IUPAC name is 4-cyclohexylsulfonyl-2-ethyl-5-methylsulfonylbenzoyl chloride.
| Compound Name | 4-cyclohexylsulfonyl-2-ethyl-5-methylsulfonylbenzoyl chloride |
|---|---|
| PubChem CID | 18927193 |
| Molecular Formula | C16H21ClO5S2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 4-cyclohexylsulfonyl-2-ethyl-5-methylsulfonylbenzoyl chloride |
| SMILES | CCc1cc(S(=O)(=O)C2CCCCC2)c(S(C)(=O)=O)cc1C(=O)Cl |
| InChI | InChI=1S/C16H21ClO5S2/c1-3-11-9-15(24(21,22)12-7-5-4-6-8-12)14(23(2,19)20)10-13(11)16(17)18/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | RXHPXXGPPBDQQO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|