4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride

C11H13ClO3S — CID 10801350

IUPAC4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride
SMILESCCc1cc(C)c(C(=O)Cl)cc1S(C)(=O)=O
InChIInChI=1S/C11H13ClO3S/c1-4-8-5-7(2)9(11(12)13)6-10(8)16(3,14)15/h5-6H,4H2,1-3H3
InChIKeyQBGBYCHFYLIJLY-UHFFFAOYSA-N
MW260.74 g/mol
LogP2.34
Rot. Bonds3

About 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride

4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride (PubChem CID 10801350) has the molecular formula C11H13ClO3S and a molecular weight of 260.74 g/mol. Its IUPAC name is 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride.

Molecular Properties

Compound Name4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride
PubChem CID10801350
Molecular FormulaC11H13ClO3S
Molecular Weight260.74 g/mol
Exact Mass260.03
IUPAC Name4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride
SMILESCCc1cc(C)c(C(=O)Cl)cc1S(C)(=O)=O
InChIInChI=1S/C11H13ClO3S/c1-4-8-5-7(2)9(11(12)13)6-10(8)16(3,14)15/h5-6H,4H2,1-3H3
InChIKeyQBGBYCHFYLIJLY-UHFFFAOYSA-N
XLogP2.34
TPSA51.21 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.74
LogP ≤ 52.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride?
The IUPAC name of 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride (CID 10801350) is 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride.
What is the SMILES notation for 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride?
The canonical SMILES for 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride is CCc1cc(C)c(C(=O)Cl)cc1S(C)(=O)=O.
What is the InChIKey of 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride?
The InChIKey is QBGBYCHFYLIJLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO3S/c1-4-8-5-7(2)9(11(12)13)6-10(8)16(3,14)15/h5-6H,4H2,1-3H3.
What are the key properties of 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride?
4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride has a molecular weight of 260.74 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methyl-5-methylsulfonylbenzoyl chloride is sourced from PubChem (CID 10801350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).