C15H11Cl3O3S — CID 10643339
4-(3,5-dichlorophenyl)-2-methyl-5-methylsulfonylbenzoyl chloride (PubChem CID 10643339) has the molecular formula C15H11Cl3O3S and a molecular weight of 377.68 g/mol. Its IUPAC name is 4-(3,5-dichlorophenyl)-2-methyl-5-methylsulfonylbenzoyl chloride.
| Compound Name | 4-(3,5-dichlorophenyl)-2-methyl-5-methylsulfonylbenzoyl chloride |
|---|---|
| PubChem CID | 10643339 |
| Molecular Formula | C15H11Cl3O3S |
| Molecular Weight | 377.68 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 4-(3,5-dichlorophenyl)-2-methyl-5-methylsulfonylbenzoyl chloride |
| SMILES | Cc1cc(-c2cc(Cl)cc(Cl)c2)c(S(C)(=O)=O)cc1C(=O)Cl |
| InChI | InChI=1S/C15H11Cl3O3S/c1-8-3-13(9-4-10(16)6-11(17)5-9)14(22(2,20)21)7-12(8)15(18)19/h3-7H,1-2H3 |
| InChIKey | QFNWHUJGJLGSDZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|