C16H21ClO3S — CID 54421606
2-ethyl-4-hex-2-enyl-5-methylsulfonylbenzoyl chloride (PubChem CID 54421606) has the molecular formula C16H21ClO3S and a molecular weight of 328.86 g/mol. Its IUPAC name is 2-ethyl-4-hex-2-enyl-5-methylsulfonylbenzoyl chloride.
| Compound Name | 2-ethyl-4-hex-2-enyl-5-methylsulfonylbenzoyl chloride |
|---|---|
| PubChem CID | 54421606 |
| Molecular Formula | C16H21ClO3S |
| Molecular Weight | 328.86 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-ethyl-4-hex-2-enyl-5-methylsulfonylbenzoyl chloride |
| SMILES | CCCC=CCc1cc(CC)c(C(=O)Cl)cc1S(C)(=O)=O |
| InChI | InChI=1S/C16H21ClO3S/c1-4-6-7-8-9-13-10-12(5-2)14(16(17)18)11-15(13)21(3,19)20/h7-8,10-11H,4-6,9H2,1-3H3 |
| InChIKey | WBFFSWVVBMYRCP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.86 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|