C12H12ClF3O3S — CID 174308093
2-[4-carbonochloridoyl-5-methyl-2-(trifluoromethyl)phenyl]propane-2-sulfinic acid (PubChem CID 174308093) has the molecular formula C12H12ClF3O3S and a molecular weight of 328.74 g/mol. Its IUPAC name is 2-[4-carbonochloridoyl-5-methyl-2-(trifluoromethyl)phenyl]propane-2-sulfinic acid.
| Compound Name | 2-[4-carbonochloridoyl-5-methyl-2-(trifluoromethyl)phenyl]propane-2-sulfinic acid |
|---|---|
| PubChem CID | 174308093 |
| Molecular Formula | C12H12ClF3O3S |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[4-carbonochloridoyl-5-methyl-2-(trifluoromethyl)phenyl]propane-2-sulfinic acid |
| SMILES | Cc1cc(C(C)(C)S(=O)O)c(C(F)(F)F)cc1C(=O)Cl |
| InChI | InChI=1S/C12H12ClF3O3S/c1-6-4-8(11(2,3)20(18)19)9(12(14,15)16)5-7(6)10(13)17/h4-5H,1-3H3,(H,18,19) |
| InChIKey | FQMWVDUUQSCPAF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|