C13H12ClF3O — CID 19688211
4-but-1-en-2-yl-2-methyl-5-(trifluoromethyl)benzoyl chloride (PubChem CID 19688211) has the molecular formula C13H12ClF3O and a molecular weight of 276.69 g/mol. Its IUPAC name is 4-but-1-en-2-yl-2-methyl-5-(trifluoromethyl)benzoyl chloride.
| Compound Name | 4-but-1-en-2-yl-2-methyl-5-(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 19688211 |
| Molecular Formula | C13H12ClF3O |
| Molecular Weight | 276.69 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 4-but-1-en-2-yl-2-methyl-5-(trifluoromethyl)benzoyl chloride |
| SMILES | C=C(CC)c1cc(C)c(C(=O)Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C13H12ClF3O/c1-4-7(2)9-5-8(3)10(12(14)18)6-11(9)13(15,16)17/h5-6H,2,4H2,1,3H3 |
| InChIKey | ZBDYFYRVSDLSRL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|