C15H11ClF3N3 — CID 133491501
3-[2-(6-chloro-3-pyridinyl)ethylamino]-4-(trifluoromethyl)benzonitrile (PubChem CID 133491501) has the molecular formula C15H11ClF3N3 and a molecular weight of 325.72 g/mol. Its IUPAC name is 3-[2-(6-chloro-3-pyridinyl)ethylamino]-4-(trifluoromethyl)benzonitrile.
| Compound Name | 3-[2-(6-chloro-3-pyridinyl)ethylamino]-4-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133491501 |
| Molecular Formula | C15H11ClF3N3 |
| Molecular Weight | 325.72 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-[2-(6-chloro-3-pyridinyl)ethylamino]-4-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)c(NCCc2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C15H11ClF3N3/c16-14-4-2-10(9-22-14)5-6-21-13-7-11(8-20)1-3-12(13)15(17,18)19/h1-4,7,9,21H,5-6H2 |
| InChIKey | IDXXOTVKTGZIHJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.72 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|