C14H13F3N4O — CID 133323513
4-[[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]amino]-3-(trifluoromethyl)benzonitrile (PubChem CID 133323513) has the molecular formula C14H13F3N4O and a molecular weight of 310.28 g/mol. Its IUPAC name is 4-[[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]amino]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]amino]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133323513 |
| Molecular Formula | C14H13F3N4O |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-[[2-hydroxy-2-(1-methylpyrazol-4-yl)ethyl]amino]-3-(trifluoromethyl)benzonitrile |
| SMILES | Cn1cc(C(O)CNc2ccc(C#N)cc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H13F3N4O/c1-21-8-10(6-20-21)13(22)7-19-12-3-2-9(5-18)4-11(12)14(15,16)17/h2-4,6,8,13,19,22H,7H2,1H3 |
| InChIKey | VTRMIKUGMJDYPO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |