C14H15F4N3O — CID 97244163
(1R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]-1-(1-methylpyrazol-4-yl)ethanol (PubChem CID 97244163) has the molecular formula C14H15F4N3O and a molecular weight of 317.29 g/mol. Its IUPAC name is (1R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]-1-(1-methylpyrazol-4-yl)ethanol.
| Compound Name | (1R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]-1-(1-methylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 97244163 |
| Molecular Formula | C14H15F4N3O |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (1R)-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]-1-(1-methylpyrazol-4-yl)ethanol |
| SMILES | Cn1cc([C@@H](O)CNCc2ccc(F)c(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C14H15F4N3O/c1-21-8-10(6-20-21)13(22)7-19-5-9-2-3-12(15)11(4-9)14(16,17)18/h2-4,6,8,13,19,22H,5,7H2,1H3/t13-/m0/s1 |
| InChIKey | HTJJRTMWWBIOLF-ZDUSSCGKSA-N |
| XLogP | 2.40 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |