C15H21F4NO — CID 103851684
3-ethyl-1-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]pentan-2-ol (PubChem CID 103851684) has the molecular formula C15H21F4NO and a molecular weight of 307.33 g/mol. Its IUPAC name is 3-ethyl-1-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]pentan-2-ol.
| Compound Name | 3-ethyl-1-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]pentan-2-ol |
|---|---|
| PubChem CID | 103851684 |
| Molecular Formula | C15H21F4NO |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 3-ethyl-1-[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]pentan-2-ol |
| SMILES | CCC(CC)C(O)CNCc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H21F4NO/c1-3-11(4-2)14(21)9-20-8-10-5-6-13(16)12(7-10)15(17,18)19/h5-7,11,14,20-21H,3-4,8-9H2,1-2H3 |
| InChIKey | HNRHRLZLTKEQMR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |