C21H20ClN3O — CID 99811946
(1S)-2-[(10-chloroanthracen-9-yl)methylamino]-1-(1-methylpyrazol-4-yl)ethanol (PubChem CID 99811946) has the molecular formula C21H20ClN3O and a molecular weight of 365.86 g/mol. Its IUPAC name is (1S)-2-[(10-chloroanthracen-9-yl)methylamino]-1-(1-methylpyrazol-4-yl)ethanol.
| Compound Name | (1S)-2-[(10-chloroanthracen-9-yl)methylamino]-1-(1-methylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 99811946 |
| Molecular Formula | C21H20ClN3O |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (1S)-2-[(10-chloroanthracen-9-yl)methylamino]-1-(1-methylpyrazol-4-yl)ethanol |
| SMILES | Cn1cc([C@H](O)CNCc2c3ccccc3c(Cl)c3ccccc23)cn1 |
| InChI | InChI=1S/C21H20ClN3O/c1-25-13-14(10-24-25)20(26)12-23-11-19-15-6-2-4-8-17(15)21(22)18-9-5-3-7-16(18)19/h2-10,13,20,23,26H,11-12H2,1H3/t20-/m1/s1 |
| InChIKey | OVQHHFBSNFHGKF-HXUWFJFHSA-N |
| XLogP | 4.20 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|