C18H20ClN3O2 — CID 154759565
2-[[2-(2-chlorophenyl)-1-(furan-3-yl)ethyl]amino]-1-(1-methylpyrazol-4-yl)ethanol (PubChem CID 154759565) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenyl)-1-(furan-3-yl)ethyl]amino]-1-(1-methylpyrazol-4-yl)ethanol.
| Compound Name | 2-[[2-(2-chlorophenyl)-1-(furan-3-yl)ethyl]amino]-1-(1-methylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 154759565 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-[[2-(2-chlorophenyl)-1-(furan-3-yl)ethyl]amino]-1-(1-methylpyrazol-4-yl)ethanol |
| SMILES | Cn1cc(C(O)CNC(Cc2ccccc2Cl)c2ccoc2)cn1 |
| InChI | InChI=1S/C18H20ClN3O2/c1-22-11-15(9-21-22)18(23)10-20-17(14-6-7-24-12-14)8-13-4-2-3-5-16(13)19/h2-7,9,11-12,17-18,20,23H,8,10H2,1H3 |
| InChIKey | WIPYNKSXKOMAIQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |