C14H15Cl2NO — CID 107308628
2-(2,3-dichlorophenyl)-N-ethyl-1-(furan-3-yl)ethanamine (PubChem CID 107308628) has the molecular formula C14H15Cl2NO and a molecular weight of 284.19 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-N-ethyl-1-(furan-3-yl)ethanamine.
| Compound Name | 2-(2,3-dichlorophenyl)-N-ethyl-1-(furan-3-yl)ethanamine |
|---|---|
| PubChem CID | 107308628 |
| Molecular Formula | C14H15Cl2NO |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-N-ethyl-1-(furan-3-yl)ethanamine |
| SMILES | CCNC(Cc1cccc(Cl)c1Cl)c1ccoc1 |
| InChI | InChI=1S/C14H15Cl2NO/c1-2-17-13(11-6-7-18-9-11)8-10-4-3-5-12(15)14(10)16/h3-7,9,13,17H,2,8H2,1H3 |
| InChIKey | LCYPSGXRKBBSHS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |