C14H15ClFNO — CID 63949608
2-(2-chloro-4-fluorophenyl)-N-ethyl-1-(furan-3-yl)ethanamine (PubChem CID 63949608) has the molecular formula C14H15ClFNO and a molecular weight of 267.73 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-N-ethyl-1-(furan-3-yl)ethanamine.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-N-ethyl-1-(furan-3-yl)ethanamine |
|---|---|
| PubChem CID | 63949608 |
| Molecular Formula | C14H15ClFNO |
| Molecular Weight | 267.73 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-N-ethyl-1-(furan-3-yl)ethanamine |
| SMILES | CCNC(Cc1ccc(F)cc1Cl)c1ccoc1 |
| InChI | InChI=1S/C14H15ClFNO/c1-2-17-14(11-5-6-18-9-11)7-10-3-4-12(16)8-13(10)15/h3-6,8-9,14,17H,2,7H2,1H3 |
| InChIKey | UAWQRTTYVSJPMK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.73 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |