C19H21NO — CID 61078930
N-[1-(furan-3-yl)-2-naphthalen-1-ylethyl]propan-1-amine (PubChem CID 61078930) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[1-(furan-3-yl)-2-naphthalen-1-ylethyl]propan-1-amine.
| Compound Name | N-[1-(furan-3-yl)-2-naphthalen-1-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 61078930 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[1-(furan-3-yl)-2-naphthalen-1-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccc2ccccc12)c1ccoc1 |
| InChI | InChI=1S/C19H21NO/c1-2-11-20-19(17-10-12-21-14-17)13-16-8-5-7-15-6-3-4-9-18(15)16/h3-10,12,14,19-20H,2,11,13H2,1H3 |
| InChIKey | FWHNSMPLZPKUON-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |