C9H13F2NO — CID 103759862
N-[2,2-difluoro-1-(furan-3-yl)ethyl]propan-1-amine (PubChem CID 103759862) has the molecular formula C9H13F2NO and a molecular weight of 189.21 g/mol. Its IUPAC name is N-[2,2-difluoro-1-(furan-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2,2-difluoro-1-(furan-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103759862 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-[2,2-difluoro-1-(furan-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(c1ccoc1)C(F)F |
| InChI | InChI=1S/C9H13F2NO/c1-2-4-12-8(9(10)11)7-3-5-13-6-7/h3,5-6,8-9,12H,2,4H2,1H3 |
| InChIKey | WPJDNYGTSFZJJW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |