C9H13F2NS — CID 103759718
N-(2,2-difluoro-1-thiophen-2-ylethyl)propan-1-amine (PubChem CID 103759718) has the molecular formula C9H13F2NS and a molecular weight of 205.27 g/mol. Its IUPAC name is N-(2,2-difluoro-1-thiophen-2-ylethyl)propan-1-amine.
| Compound Name | N-(2,2-difluoro-1-thiophen-2-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 103759718 |
| Molecular Formula | C9H13F2NS |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | N-(2,2-difluoro-1-thiophen-2-ylethyl)propan-1-amine |
| SMILES | CCCNC(c1cccs1)C(F)F |
| InChI | InChI=1S/C9H13F2NS/c1-2-5-12-8(9(10)11)7-4-3-6-13-7/h3-4,6,8-9,12H,2,5H2,1H3 |
| InChIKey | TWKFJKCTHZPVHM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |