C15H18INO — CID 114030122
N-[furan-3-yl-(2-iodo-3-methylphenyl)methyl]propan-1-amine (PubChem CID 114030122) has the molecular formula C15H18INO and a molecular weight of 355.22 g/mol. Its IUPAC name is N-[furan-3-yl-(2-iodo-3-methylphenyl)methyl]propan-1-amine.
| Compound Name | N-[furan-3-yl-(2-iodo-3-methylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114030122 |
| Molecular Formula | C15H18INO |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-[furan-3-yl-(2-iodo-3-methylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccoc1)c1cccc(C)c1I |
| InChI | InChI=1S/C15H18INO/c1-3-8-17-15(12-7-9-18-10-12)13-6-4-5-11(2)14(13)16/h4-7,9-10,15,17H,3,8H2,1-2H3 |
| InChIKey | UJFFETWUIDHYKS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|