C13H20N4O — CID 114687797
N-[furan-3-yl-(3-propyltriazol-4-yl)methyl]propan-1-amine (PubChem CID 114687797) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is N-[furan-3-yl-(3-propyltriazol-4-yl)methyl]propan-1-amine.
| Compound Name | N-[furan-3-yl-(3-propyltriazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114687797 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | N-[furan-3-yl-(3-propyltriazol-4-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccoc1)c1cnnn1CCC |
| InChI | InChI=1S/C13H20N4O/c1-3-6-14-13(11-5-8-18-10-11)12-9-15-16-17(12)7-4-2/h5,8-10,13-14H,3-4,6-7H2,1-2H3 |
| InChIKey | NPXUJDIPDNMPQX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |