C15H20ClIN4 — CID 103216251
N-[(3-chloro-4-iodophenyl)-(3-propyltriazol-4-yl)methyl]propan-1-amine (PubChem CID 103216251) has the molecular formula C15H20ClIN4 and a molecular weight of 418.71 g/mol. Its IUPAC name is N-[(3-chloro-4-iodophenyl)-(3-propyltriazol-4-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-chloro-4-iodophenyl)-(3-propyltriazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103216251 |
| Molecular Formula | C15H20ClIN4 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N-[(3-chloro-4-iodophenyl)-(3-propyltriazol-4-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(I)c(Cl)c1)c1cnnn1CCC |
| InChI | InChI=1S/C15H20ClIN4/c1-3-7-18-15(11-5-6-13(17)12(16)9-11)14-10-19-20-21(14)8-4-2/h5-6,9-10,15,18H,3-4,7-8H2,1-2H3 |
| InChIKey | RTCJRMUOQDXMPQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|