C14H16Cl2IN3 — CID 103216306
1-(3-chloro-4-iodophenyl)-1-(4-chloro-1-propylpyrazol-5-yl)-N-methylmethanamine (PubChem CID 103216306) has the molecular formula C14H16Cl2IN3 and a molecular weight of 424.11 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-1-(4-chloro-1-propylpyrazol-5-yl)-N-methylmethanamine.
| Compound Name | 1-(3-chloro-4-iodophenyl)-1-(4-chloro-1-propylpyrazol-5-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 103216306 |
| Molecular Formula | C14H16Cl2IN3 |
| Molecular Weight | 424.11 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-1-(4-chloro-1-propylpyrazol-5-yl)-N-methylmethanamine |
| SMILES | CCCn1ncc(Cl)c1C(NC)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2IN3/c1-3-6-20-14(11(16)8-19-20)13(18-2)9-4-5-12(17)10(15)7-9/h4-5,7-8,13,18H,3,6H2,1-2H3 |
| InChIKey | IXFZTDCMTZSMBE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.11 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|