C12H16ClN3O — CID 114649703
1-(4-chloro-1-propylpyrazol-5-yl)-1-(furan-2-yl)-N-methylmethanamine (PubChem CID 114649703) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is 1-(4-chloro-1-propylpyrazol-5-yl)-1-(furan-2-yl)-N-methylmethanamine.
| Compound Name | 1-(4-chloro-1-propylpyrazol-5-yl)-1-(furan-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114649703 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1-(4-chloro-1-propylpyrazol-5-yl)-1-(furan-2-yl)-N-methylmethanamine |
| SMILES | CCCn1ncc(Cl)c1C(NC)c1ccco1 |
| InChI | InChI=1S/C12H16ClN3O/c1-3-6-16-12(9(13)8-15-16)11(14-2)10-5-4-7-17-10/h4-5,7-8,11,14H,3,6H2,1-2H3 |
| InChIKey | NUWXCLGQZGFWIC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |