C16H21ClIN3 — CID 103215312
N-[(3-chloro-4-iodophenyl)-(1-propylimidazol-2-yl)methyl]propan-1-amine (PubChem CID 103215312) has the molecular formula C16H21ClIN3 and a molecular weight of 417.72 g/mol. Its IUPAC name is N-[(3-chloro-4-iodophenyl)-(1-propylimidazol-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-chloro-4-iodophenyl)-(1-propylimidazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103215312 |
| Molecular Formula | C16H21ClIN3 |
| Molecular Weight | 417.72 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | N-[(3-chloro-4-iodophenyl)-(1-propylimidazol-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(I)c(Cl)c1)c1nccn1CCC |
| InChI | InChI=1S/C16H21ClIN3/c1-3-7-19-15(12-5-6-14(18)13(17)11-12)16-20-8-10-21(16)9-4-2/h5-6,8,10-11,15,19H,3-4,7,9H2,1-2H3 |
| InChIKey | NJDPGDCICWTGEK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|