C14H16ClIN2O — CID 103216978
1-(3-chloro-4-iodophenyl)-2-(1-propylimidazol-2-yl)ethanol (PubChem CID 103216978) has the molecular formula C14H16ClIN2O and a molecular weight of 390.65 g/mol. Its IUPAC name is 1-(3-chloro-4-iodophenyl)-2-(1-propylimidazol-2-yl)ethanol.
| Compound Name | 1-(3-chloro-4-iodophenyl)-2-(1-propylimidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 103216978 |
| Molecular Formula | C14H16ClIN2O |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 1-(3-chloro-4-iodophenyl)-2-(1-propylimidazol-2-yl)ethanol |
| SMILES | CCCn1ccnc1CC(O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClIN2O/c1-2-6-18-7-5-17-14(18)9-13(19)10-3-4-12(16)11(15)8-10/h3-5,7-8,13,19H,2,6,9H2,1H3 |
| InChIKey | WBVLKVDUXVDTEK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|