C12H18N6 — CID 102923832
N-[(3-propyltriazol-4-yl)-pyrimidin-5-ylmethyl]ethanamine (PubChem CID 102923832) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is N-[(3-propyltriazol-4-yl)-pyrimidin-5-ylmethyl]ethanamine.
| Compound Name | N-[(3-propyltriazol-4-yl)-pyrimidin-5-ylmethyl]ethanamine |
|---|---|
| PubChem CID | 102923832 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N-[(3-propyltriazol-4-yl)-pyrimidin-5-ylmethyl]ethanamine |
| SMILES | CCCn1nncc1C(NCC)c1cncnc1 |
| InChI | InChI=1S/C12H18N6/c1-3-5-18-11(8-16-17-18)12(15-4-2)10-6-13-9-14-7-10/h6-9,12,15H,3-5H2,1-2H3 |
| InChIKey | JLIBCTDKKJTLEK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |