C17H19Cl2NO — CID 70002682
(1R)-1-(4-chlorophenyl)-2-[1-(2-chlorophenyl)propan-2-ylamino]ethanol (PubChem CID 70002682) has the molecular formula C17H19Cl2NO and a molecular weight of 324.25 g/mol. Its IUPAC name is (1R)-1-(4-chlorophenyl)-2-[1-(2-chlorophenyl)propan-2-ylamino]ethanol.
| Compound Name | (1R)-1-(4-chlorophenyl)-2-[1-(2-chlorophenyl)propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 70002682 |
| Molecular Formula | C17H19Cl2NO |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (1R)-1-(4-chlorophenyl)-2-[1-(2-chlorophenyl)propan-2-ylamino]ethanol |
| SMILES | CC(Cc1ccccc1Cl)NC[C@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2NO/c1-12(10-14-4-2-3-5-16(14)19)20-11-17(21)13-6-8-15(18)9-7-13/h2-9,12,17,20-21H,10-11H2,1H3/t12?,17-/m0/s1 |
| InChIKey | GJYWSNKEAOIYNA-TYJDENFWSA-N |
| XLogP | 4.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |