C19H22F3NO — CID 54087155
(1R)-2-[[(2R)-1-(2-methylphenyl)propan-2-yl]amino]-1-[4-(trifluoromethyl)phenyl]ethanol (PubChem CID 54087155) has the molecular formula C19H22F3NO and a molecular weight of 337.39 g/mol. Its IUPAC name is (1R)-2-[[(2R)-1-(2-methylphenyl)propan-2-yl]amino]-1-[4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | (1R)-2-[[(2R)-1-(2-methylphenyl)propan-2-yl]amino]-1-[4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 54087155 |
| Molecular Formula | C19H22F3NO |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (1R)-2-[[(2R)-1-(2-methylphenyl)propan-2-yl]amino]-1-[4-(trifluoromethyl)phenyl]ethanol |
| SMILES | Cc1ccccc1C[C@@H](C)NC[C@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F3NO/c1-13-5-3-4-6-16(13)11-14(2)23-12-18(24)15-7-9-17(10-8-15)19(20,21)22/h3-10,14,18,23-24H,11-12H2,1-2H3/t14-,18+/m1/s1 |
| InChIKey | MRHAWEYBNRGNJT-KDOFPFPSSA-N |
| XLogP | 4.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |