C14H18F3NO3 — CID 61499161
ethyl 2-[[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]amino]propanoate (PubChem CID 61499161) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is ethyl 2-[[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]amino]propanoate.
| Compound Name | ethyl 2-[[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]amino]propanoate |
|---|---|
| PubChem CID | 61499161 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | ethyl 2-[[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NCC(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3NO3/c1-3-21-13(20)9(2)18-8-12(19)10-4-6-11(7-5-10)14(15,16)17/h4-7,9,12,18-19H,3,8H2,1-2H3 |
| InChIKey | YJAPYKMCZAPDOW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |