C18H22ClNO2 — CID 18628145
2-[1-(2-chlorophenyl)propan-2-ylamino]-1-(2-methoxyphenyl)ethanol (PubChem CID 18628145) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)propan-2-ylamino]-1-(2-methoxyphenyl)ethanol.
| Compound Name | 2-[1-(2-chlorophenyl)propan-2-ylamino]-1-(2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 18628145 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[1-(2-chlorophenyl)propan-2-ylamino]-1-(2-methoxyphenyl)ethanol |
| SMILES | COc1ccccc1C(O)CNC(C)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H22ClNO2/c1-13(11-14-7-3-5-9-16(14)19)20-12-17(21)15-8-4-6-10-18(15)22-2/h3-10,13,17,20-21H,11-12H2,1-2H3 |
| InChIKey | DDFICJGLUASHCE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |